CAS 26933-87-9 appears in our catalog under these names: 2-Pyrenecarboxaldehyde, 95%, 95%, Pyrene-2-carbaldehyde, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Pyrene-2-carbaldehyde (CAS 26933-87-9) is a chemical compound with the molecular formula C17H10O and a molecular weight of 230.26 g/mol. IUPAC name: pyrene-2-carbaldehyde. InChIKey: HCZHFOVHJWZHFP-UHFFFAOYSA-N.
| Molecular formula | C17H10O |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | pyrene-2-carbaldehyde |
| InChIKey | HCZHFOVHJWZHFP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC(=C4)C=O)C=C2 |
Computed by PubChem (NCBI)