CAS 3029-19-4 appears in our catalog under these names: 1-Pyrenecarboxaldehyde, 1–Pyrenecarboxaldehyde, 1-Pyrenecarboxaldehyde, 98+% , 1-Pyrenecarboxaldehyde, >98.0%(GC), 3-Pyrenylaldehyde 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, TCI. Available pack sizes: 10g, 25g, 5g, 100g, 20g, 1g, 500g, 1000g.
Pyrene-1-carbaldehyde (CAS 3029-19-4) is a chemical compound with the molecular formula C17H10O and a molecular weight of 230.26 g/mol. IUPAC name: pyrene-1-carbaldehyde. InChIKey: RCYFOPUXRMOLQM-UHFFFAOYSA-N.
| Molecular formula | C17H10O |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | pyrene-1-carbaldehyde |
| InChIKey | RCYFOPUXRMOLQM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C=O |
Computed by PubChem (NCBI)