CAS 6051-98-5 appears in our catalog under these names: 7H-Benzo[c]fluoren-7-one, 98%, 98%, 7H-Benzo[c]fluoren-7-one 98%, 7H-BENZO[C]FLUOREN-7-ONE, 98%, 7H-Benzo[c]fluoren-7-one, 95%, allo-Chrysoketone. Offered by: Chemat, Ambeed, Fluorochem, Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 5g, 5mg.
Benzo[c]fluoren-7-one (CAS 6051-98-5) is a chemical compound with the molecular formula C17H10O and a molecular weight of 230.26 g/mol. IUPAC name: benzo[c]fluoren-7-one. InChIKey: USYWCEDYVLPNHH-UHFFFAOYSA-N.
| Molecular formula | C17H10O |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | benzo[c]fluoren-7-one |
| InChIKey | USYWCEDYVLPNHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)