Products 479-79-8
CAS 479-79-8 appears in our catalog under these names: Benzo(a)fluoren-11-one, >95% (HPLC), 11H–Benzo(a)fluoren–11–one, 11H-Benzo[a]fluoren-11-one, >98.0%(GC), 11H-Benzo[a]fluoren-11-one 98%, 80657, Benzo[a]fluorenone (purity). Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 5g, 10MG, 1x20mg.
Benzo[a]fluoren-11-one (CAS 479-79-8) is a chemical compound with the molecular formula C17H10O and a molecular weight of 230.26 g/mol. IUPAC name: benzo[a]fluoren-11-one. InChIKey: RNICURKFVSAHLQ-UHFFFAOYSA-N.
| Molecular formula | C17H10O |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | benzo[a]fluoren-11-one |
| InChIKey | RNICURKFVSAHLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=O)C4=CC=CC=C34 |
Computed by PubChem (NCBI)