cas: 88238-73-7 — see every product listed under this CAS number, including other names
8-(Benzyloxy)quinoline-2-carbaldehyde, 98+% (CAS 88238-73-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A885175-5g |
| cas | 88238-73-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8480.92 Pln | |
| AmBeed | 250mg | 1189.72 Pln | |
| AmBeed | 100mg | 909.79 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
8-phenylmethoxyquinoline-2-carbaldehyde (CAS 88238-73-7) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 8-phenylmethoxyquinoline-2-carbaldehyde. InChIKey: DNRDUAQLBRLDGI-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 8-phenylmethoxyquinoline-2-carbaldehyde |
| InChIKey | DNRDUAQLBRLDGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC3=C2N=C(C=C3)C=O |
Computed by PubChem (NCBI)