cas: 1391732-45-8 — see every product listed under this CAS number, including other names
8-(tert-Butyl) 2-methyl 8-azaspiro[4.5]decane-2,8-dicarboxylate, 95% (CAS 1391732-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602361-100MG |
| cas | 1391732-45-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1846.24 Pln | |
| Fluorochem | 250mg | 2528.29 Pln | |
| Fluorochem | 500mg | 3413.40 Pln | |
| Fluorochem | 1g | 4912.87 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate (CAS 1391732-45-8) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate. InChIKey: MTIWDIYQTBHBSX-UHFFFAOYSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate |
| InChIKey | MTIWDIYQTBHBSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C2)C(=O)OC)CC1 |
Computed by PubChem (NCBI)