cas: 6748-68-1 — see every product listed under this CAS number, including other names
8-Acetyl-7-Hydroxycoumarin, 97%(GC-MS),RG, 97%(GC-MS),RG (CAS 6748-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NH0-250mg |
| cas | 6748-68-1 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1763.60 Pln |
| purity | 97%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
8-acetyl-7-hydroxychromen-2-one (CAS 6748-68-1) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 8-acetyl-7-hydroxychromen-2-one. InChIKey: XWYMACPLPPQCHC-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 8-acetyl-7-hydroxychromen-2-one |
| InChIKey | XWYMACPLPPQCHC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC2=C1OC(=O)C=C2)O |
Computed by PubChem (NCBI)