cas: 197507-55-4 — see every product listed under this CAS number, including other names
8-Bromo-1,6-naphthyridine-2-carboxylic acid, 95% (CAS 197507-55-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-6814-1g |
| cas | 197507-55-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1034.03 Pln | |
| Fluorochem | 5g | 3007.29 Pln | |
| Fluorochem | 10g | 5964.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
8-bromo-1,6-naphthyridine-2-carboxylic acid (CAS 197507-55-4) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 8-bromo-1,6-naphthyridine-2-carboxylic acid. InChIKey: ISJKXVUODLFGIU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 8-bromo-1,6-naphthyridine-2-carboxylic acid |
| InChIKey | ISJKXVUODLFGIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C(C=NC=C21)Br)C(=O)O |
Computed by PubChem (NCBI)