cas: 63845-72-7 — see every product listed under this CAS number, including other names
8-Bromo-1,7-naphthyridine, 96% (CAS 63845-72-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221257-100MG |
| cas | 63845-72-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 914.28 Pln | |
| Fluorochem | 5g | 4006.94 Pln | |
| Fluorochem | 10g | 7495.30 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-1,7-naphthyridine (CAS 63845-72-7) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 8-bromo-1,7-naphthyridine. InChIKey: ZMRBFCVWSDKLLT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 8-bromo-1,7-naphthyridine |
| InChIKey | ZMRBFCVWSDKLLT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)Br)N=C1 |
Computed by PubChem (NCBI)