cas: 331647-05-3 — see every product listed under this CAS number, including other names
8-Bromo-2,4-dichloroquinazoline, 97% (CAS 331647-05-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077198-5G |
| cas | 331647-05-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 700.81 Pln | |
| Fluorochem | 10g | 1174.60 Pln | |
| Fluorochem | 25g | 2517.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-2,4-dichloroquinazoline (CAS 331647-05-3) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 8-bromo-2,4-dichloroquinazoline. InChIKey: BHXJPWCPEFXWMH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 8-bromo-2,4-dichloroquinazoline |
| InChIKey | BHXJPWCPEFXWMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)