cas: 252861-41-9 — see every product listed under this CAS number, including other names
8-Bromo-5-nitroisoquinoline, 98% (CAS 252861-41-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092408-250MG |
| cas | 252861-41-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1257.91 Pln | |
| Fluorochem | 10g | 2346.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-5-nitroisoquinoline (CAS 252861-41-9) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 8-bromo-5-nitroisoquinoline. InChIKey: BCQCHGICDSWPJK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 8-bromo-5-nitroisoquinoline |
| InChIKey | BCQCHGICDSWPJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NC=CC2=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)