8-Bromo-5-nitroisoquinoline, 98%
cas: 252861-41-9 — see every product listed under this CAS number, including other names
8-Bromo-5-nitroisoquinoline, 98% (CAS 252861-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F092408-100MG |
| cas | 252861-41-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 430.07 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2444.99 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1850.00 Pln | |
| Chemat | 10g | 3328.40 Pln | |
| Chemat | 25g | 6683.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
8-bromo-5-nitroisoquinoline (CAS 252861-41-9) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 8-bromo-5-nitroisoquinoline. InChIKey: BCQCHGICDSWPJK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 8-bromo-5-nitroisoquinoline |
| InChIKey | BCQCHGICDSWPJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NC=CC2=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)
Synonyms:
8-Bromo-5-nitro-isoquinoline