cas: 915976-85-1 — see every product listed under this CAS number, including other names
8-Bromo-7-chloro-2-methoxy-[1,5]naphthyridine-, 97%, 97% (CAS 915976-85-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGS8-100mg |
| cas | 915976-85-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1350.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-bromo-7-chloro-2-methoxy-1,5-naphthyridine (CAS 915976-85-1) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 8-bromo-7-chloro-2-methoxy-1,5-naphthyridine. InChIKey: XZFOYBCRHMSKFH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 8-bromo-7-chloro-2-methoxy-1,5-naphthyridine |
| InChIKey | XZFOYBCRHMSKFH-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C(=CN=C2C=C1)Cl)Br |
Computed by PubChem (NCBI)