Products 87779-01-9
CAS 87779-01-9 is the registry number for 3-Bromo-2-(chloromethyl)-4h-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-bromo-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one (CAS 87779-01-9) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 3-bromo-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: UOQARUIEXGTABL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 3-bromo-2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | UOQARUIEXGTABL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C(=O)N2C=C1)Br)CCl |
Computed by PubChem (NCBI)