CAS 915976-85-1 appears in our catalog under these names: 8-Bromo-7-chloro-2-methoxy-1,5-naphthyridine, 95%, 8-Bromo-7-chloro-2-methoxy-[1,5]naphthyridine-, 97%, 97%, 8-Bromo-7-chloro-2-methoxy-1,5-naphthyridine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
8-bromo-7-chloro-2-methoxy-1,5-naphthyridine (CAS 915976-85-1) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 8-bromo-7-chloro-2-methoxy-1,5-naphthyridine. InChIKey: XZFOYBCRHMSKFH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 8-bromo-7-chloro-2-methoxy-1,5-naphthyridine |
| InChIKey | XZFOYBCRHMSKFH-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C(=CN=C2C=C1)Cl)Br |
Computed by PubChem (NCBI)