Products 944391-84-8
CAS 944391-84-8 appears in our catalog under these names: 2-(3-Bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole, 98%, 2-(3-Bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g, 2,5g.
2-(3-bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole (CAS 944391-84-8) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 2-(3-bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole. InChIKey: XKGWFTUQBXSVSK-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-(3-bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole |
| InChIKey | XKGWFTUQBXSVSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)