Products 568544-04-7
CAS 568544-04-7 appears in our catalog under these names: 2-(4-Bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole, 98%, 2-(4-Bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole, 95%, 95%, 2-(4-Bromo-phenyl)-5-chloromethyl-[1,3,4]oxadiazole, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
2-(4-bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole (CAS 568544-04-7) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 2-(4-bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole. InChIKey: JJZRXTXSRJLBRX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5-(chloromethyl)-1,3,4-oxadiazole |
| InChIKey | JJZRXTXSRJLBRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CCl)Br |
Computed by PubChem (NCBI)