cas: 1194375-12-6 — see every product listed under this CAS number, including other names
8-Bromoimidazo[1,2-A]Pyridine-2-Carbaldehyde, 97%, 97% (CAS 1194375-12-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IS4-100mg |
| cas | 1194375-12-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1413.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-bromoimidazo[1,2-a]pyridine-2-carbaldehyde (CAS 1194375-12-6) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 8-bromoimidazo[1,2-a]pyridine-2-carbaldehyde. InChIKey: DDCSWBYPSZSEHW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 8-bromoimidazo[1,2-a]pyridine-2-carbaldehyde |
| InChIKey | DDCSWBYPSZSEHW-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=C1)Br)C=O |
Computed by PubChem (NCBI)