8-Bromoisoquinolin-3-ol, 95+%
cas: 2159072-71-4 — see every product listed under this CAS number, including other names
8-Bromoisoquinolin-3-ol, 95+% (CAS 2159072-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A850934-250mg |
| cas | 2159072-71-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1822.19 Pln | |
| Ambeed | 5g | 6205.44 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1730.00 Pln | |
| Chemat | 5g | 5886.80 Pln | |
| BLDpharm | 250mg | 708.66 Pln | |
| BLDpharm | 1g | 1786.06 Pln | |
| BLDpharm | 5g | 6084.55 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
8-bromo-2H-isoquinolin-3-one (CAS 2159072-71-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromo-2H-isoquinolin-3-one. InChIKey: IVDPIQOKPLLJPF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromo-2H-isoquinolin-3-one |
| InChIKey | IVDPIQOKPLLJPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=O)NC=C2C(=C1)Br |
Computed by PubChem (NCBI)