CAS 2159072-71-4 appears in our catalog under these names: 8-Bromoisoquinolin-3-ol 95+%, 8-Bromoisoquinolin-3-ol, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
8-bromo-2H-isoquinolin-3-one (CAS 2159072-71-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromo-2H-isoquinolin-3-one. InChIKey: IVDPIQOKPLLJPF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromo-2H-isoquinolin-3-one |
| InChIKey | IVDPIQOKPLLJPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=O)NC=C2C(=C1)Br |
Computed by PubChem (NCBI)