8-Chloroisoquinoline, 98%
cas: 34784-07-1 — see every product listed under this CAS number, including other names
8-Chloroisoquinoline, 98% (CAS 34784-07-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A144432-250mg |
| cas | 34784-07-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 25g | 548.38 Pln | |
| Ambeed | 100g | 1549.62 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 192.18 Pln | |
| BLDpharm | 25g | 580.93 Pln | |
| BLDpharm | 100g | 1669.44 Pln | |
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 544.62 Pln | |
| Fluorochem | 100g | 1591.12 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
8-chloroisoquinoline (CAS 34784-07-1) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 8-chloroisoquinoline. InChIKey: OXAMVYYZTULFIB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 8-chloroisoquinoline |
| InChIKey | OXAMVYYZTULFIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)Cl |
Computed by PubChem (NCBI)