cas: 21141-35-5 — see every product listed under this CAS number, including other names
8-Methoxyquinoline-2-carboxylic acid, 95%, 95% (CAS 21141-35-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113LBK-100mg |
| cas | 21141-35-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 621.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-methoxyquinoline-2-carboxylic acid (CAS 21141-35-5) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 8-methoxyquinoline-2-carboxylic acid. InChIKey: RAZRTJLTLNPWKV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 8-methoxyquinoline-2-carboxylic acid |
| InChIKey | RAZRTJLTLNPWKV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)