cas: 1025010-58-5 — see every product listed under this CAS number, including other names
8-Methyl-5-quinolineboronic Acid, 98%, 98% (CAS 1025010-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118L7-100mg |
| cas | 1025010-58-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2474.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(8-methylquinolin-5-yl)boronic acid (CAS 1025010-58-5) is a chemical compound with the molecular formula C10H10BNO2 and a molecular weight of 187.00 g/mol. IUPAC name: (8-methylquinolin-5-yl)boronic acid. InChIKey: IFARJKOFXMGAPR-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO2 |
|---|---|
| Molecular weight | 187.00 g/mol |
| IUPAC name | (8-methylquinolin-5-yl)boronic acid |
| InChIKey | IFARJKOFXMGAPR-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=NC2=C(C=C1)C)(O)O |
Computed by PubChem (NCBI)