Products 1154741-19-1
CAS 1154741-19-1 appears in our catalog under these names: (5-Methylquinolin-8-yl)boronic acid, 95%, (5-Methylquinolin-8-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(5-methylquinolin-8-yl)boronic acid (CAS 1154741-19-1) is a chemical compound with the molecular formula C10H10BNO2 and a molecular weight of 187.00 g/mol. IUPAC name: (5-methylquinolin-8-yl)boronic acid. InChIKey: LXSOTTKBEWZBRX-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO2 |
|---|---|
| Molecular weight | 187.00 g/mol |
| IUPAC name | (5-methylquinolin-8-yl)boronic acid |
| InChIKey | LXSOTTKBEWZBRX-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=C(C=C1)C)C=CC=N2)(O)O |
Computed by PubChem (NCBI)