Products 2260683-75-6
CAS 2260683-75-6 appears in our catalog under these names: (8-Methylquinolin-6-yl)boronic acid, 96%, (8-Methylquinolin-6-yl)boronic acid 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
(8-methylquinolin-6-yl)boronic acid (CAS 2260683-75-6) is a chemical compound with the molecular formula C10H10BNO2 and a molecular weight of 187.00 g/mol. IUPAC name: (8-methylquinolin-6-yl)boronic acid. InChIKey: KPWIXZPDEDRDPT-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO2 |
|---|---|
| Molecular weight | 187.00 g/mol |
| IUPAC name | (8-methylquinolin-6-yl)boronic acid |
| InChIKey | KPWIXZPDEDRDPT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C2C(=C1)C=CC=N2)C)(O)O |
Computed by PubChem (NCBI)