Products 2096334-10-8
CAS 2096334-10-8 appears in our catalog under these names: 3-(1-Cyanocyclopropyl)phenylboronic acid, 96%, 3-(1-Cyanocyclopropyl)phenylboronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
[3-(1-cyanocyclopropyl)phenyl]boronic acid (CAS 2096334-10-8) is a chemical compound with the molecular formula C10H10BNO2 and a molecular weight of 187.00 g/mol. IUPAC name: [3-(1-cyanocyclopropyl)phenyl]boronic acid. InChIKey: QPFQYMMRBKIABU-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO2 |
|---|---|
| Molecular weight | 187.00 g/mol |
| IUPAC name | [3-(1-cyanocyclopropyl)phenyl]boronic acid |
| InChIKey | QPFQYMMRBKIABU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2(CC2)C#N)(O)O |
Computed by PubChem (NCBI)