Products 1092790-20-9
CAS 1092790-20-9 appears in our catalog under these names: 2-Methylquinoline-6-boronic acid, 95%, (2-Methyl-6-quinolinyl)boronic acid, 95-<97%, (2-Methyl-6-quinolinyl)boronic acid, ≥97-<99%, (2-Methylquinolin-6-yl)boronic acid, 97%, (2-Methyl-6-quinolinyl). Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 2,5g, 25g, 50g.
(2-methylquinolin-6-yl)boronic acid (CAS 1092790-20-9) is a chemical compound with the molecular formula C10H10BNO2 and a molecular weight of 187.00 g/mol. IUPAC name: (2-methylquinolin-6-yl)boronic acid. InChIKey: MVMHGLOKEZYGNG-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO2 |
|---|---|
| Molecular weight | 187.00 g/mol |
| IUPAC name | (2-methylquinolin-6-yl)boronic acid |
| InChIKey | MVMHGLOKEZYGNG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)