8-bromoisoquinolin-3-ol, 98%
cas: 608515-49-7 — see every product listed under this CAS number, including other names
8-bromoisoquinolin-3-ol, 98% (CAS 608515-49-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EE9R-100mg |
| cas | 608515-49-7 |
| size | 100mg |
| availability | 250g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 500mg | 251.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3165.20 Pln | |
| Chemat | 50g | 5229.20 Pln | |
| Chemat | 100g | 5848.40 Pln | |
| Chemat | 250g | 11867.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-bromo-2H-isoquinolin-3-one (CAS 608515-49-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromo-2H-isoquinolin-3-one. InChIKey: IVDPIQOKPLLJPF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromo-2H-isoquinolin-3-one |
| InChIKey | IVDPIQOKPLLJPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=O)NC=C2C(=C1)Br |
Computed by PubChem (NCBI)