cas: 182121-12-6 — see every product listed under this CAS number, including other names
9,9-Bis(methoxymethyl)-9H-fluorene 99% (CAS 182121-12-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156007-100mg |
| cas | 182121-12-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 10g | 359.25 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Ambeed | 100g | 1471.75 Pln | |
| Ambeed | 500g | 5682.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156007 |
9,9-bis(methoxymethyl)fluorene (CAS 182121-12-6) is a chemical compound with the molecular formula C17H18O2 and a molecular weight of 254.32 g/mol. IUPAC name: 9,9-bis(methoxymethyl)fluorene. InChIKey: ZWINORFLMHROGF-UHFFFAOYSA-N.
| Molecular formula | C17H18O2 |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 9,9-bis(methoxymethyl)fluorene |
| InChIKey | ZWINORFLMHROGF-UHFFFAOYSA-N |
| SMILES | COCC1(C2=CC=CC=C2C3=CC=CC=C31)COC |
Computed by PubChem (NCBI)