cas: 262861-81-4 — see every product listed under this CAS number, including other names
9-(4-Ethynylphenyl)carbazole, 98% (CAS 262861-81-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A199021-100mg |
| cas | 262861-81-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 665.19 Pln | |
| Ambeed | 5g | 2167.06 Pln | |
| Ambeed | 10g | 3424.19 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 714.22 Pln | |
| BLDpharm | 5g | 2330.32 Pln | |
| BLDpharm | 10g | 3685.39 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
9-(4-ethynylphenyl)carbazole (CAS 262861-81-4) is a chemical compound with the molecular formula C20H13N and a molecular weight of 267.3 g/mol. IUPAC name: 9-(4-ethynylphenyl)carbazole. InChIKey: JJIQKIUIIVFHAN-UHFFFAOYSA-N.
| Molecular formula | C20H13N |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 9-(4-ethynylphenyl)carbazole |
| InChIKey | JJIQKIUIIVFHAN-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)N2C3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)