Products 35337-21-4
CAS 35337-21-4 is the registry number for Perylen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Perylen-1-amine (CAS 35337-21-4) is a chemical compound with the molecular formula C20H13N and a molecular weight of 267.3 g/mol. IUPAC name: perylen-1-amine. InChIKey: XDCVFPZJEDYBRG-UHFFFAOYSA-N.
| Molecular formula | C20H13N |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | perylen-1-amine |
| InChIKey | XDCVFPZJEDYBRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=CC=CC5=C4C(=C(C=C5)N)C3=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
aminoperylene, 1-Perylenamine