Products 20492-13-1
CAS 20492-13-1 is the registry number for Perylen-3-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Perylen-3-amine (CAS 20492-13-1) is a chemical compound with the molecular formula C20H13N and a molecular weight of 267.3 g/mol. IUPAC name: perylen-3-amine. InChIKey: IQEWYVIHLJJXKR-UHFFFAOYSA-N.
| Molecular formula | C20H13N |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | perylen-3-amine |
| InChIKey | IQEWYVIHLJJXKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=C5C(=CC=C4)C(=CC=C5C3=CC=C2)N |
Computed by PubChem (NCBI)