CAS 63018-69-9 is the registry number for Benz(a)anthracene-7-acetonitrile. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg.
2-benzo[a]anthracen-7-ylacetonitrile (CAS 63018-69-9) is a chemical compound with the molecular formula C20H13N and a molecular weight of 267.3 g/mol. IUPAC name: 2-benzo[a]anthracen-7-ylacetonitrile. InChIKey: GHUUNAACTDWPKC-UHFFFAOYSA-N.
| Molecular formula | C20H13N |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 2-benzo[a]anthracen-7-ylacetonitrile |
| InChIKey | GHUUNAACTDWPKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C4=CC=CC=C4C=C32)CC#N |
Computed by PubChem (NCBI)