Products 239-64-5
CAS 239-64-5 appears in our catalog under these names: 13H-Dibenzo[a,i]carbazole, 95%, 95%, 13H-Dibenzo[a,i]carbazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (CAS 239-64-5) is a chemical compound with the molecular formula C20H13N and a molecular weight of 267.3 g/mol. IUPAC name: 12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene. InChIKey: IUILSTHMSGDSHQ-UHFFFAOYSA-N.
| Molecular formula | C20H13N |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| InChIKey | IUILSTHMSGDSHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2NC4=C3C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)