cas: 716-53-0 — see every product listed under this CAS number, including other names
9-Chloroanthracene, 95% (CAS 716-53-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F237123-250MG |
| cas | 716-53-0 |
| size | 250mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 10g | 664.37 Pln | |
| Fluorochem | 25g | 1164.19 Pln | |
| Fluorochem | 100g | 3527.94 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 25g | 1126.88 Pln | |
| Ambeed | 100g | 3457.56 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
9-chloroanthracene (CAS 716-53-0) is a chemical compound with the molecular formula C14H9Cl and a molecular weight of 212.67 g/mol. IUPAC name: 9-chloroanthracene. InChIKey: KULLJOPUZUWTMF-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 9-chloroanthracene |
| InChIKey | KULLJOPUZUWTMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Cl |
Computed by PubChem (NCBI)