Products 2742214-71-5
CAS 2742214-71-5 is the registry number for 2-Chloroanthracene-13C6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-chloroanthracene (CAS 2742214-71-5) is a chemical compound with the molecular formula C14H9Cl and a molecular weight of 218.63 g/mol. IUPAC name: 2-chloroanthracene. InChIKey: OWFINXQLBMJDJQ-JZIMGQPFSA-N.
| Molecular formula | C14H9Cl |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 2-chloroanthracene |
| InChIKey | OWFINXQLBMJDJQ-JZIMGQPFSA-N |
| SMILES | C1=CC2=C[13C]3=[13CH][13CH]=[13CH][13CH]=[13C]3C=C2C=C1Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Chloroanthracene-13C6, orb3135154