cas: 1823229-54-4 — see every product listed under this CAS number, including other names
9-tert-Butyl 7-methyl (1r,5s)-3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate, 97%, 97% (CAS 1823229-54-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134MO-50mg |
| cas | 1823229-54-4 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 510.80 Pln | |
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1182.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9-O-tert-butyl 7-O-methyl 3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate (CAS 1823229-54-4) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 9-O-tert-butyl 7-O-methyl 3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate. InChIKey: UUIAWYLQFAYJMO-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 9-O-tert-butyl 7-O-methyl 3-oxa-9-azabicyclo[3.3.1]nonane-7,9-dicarboxylate |
| InChIKey | UUIAWYLQFAYJMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CC(CC1COC2)C(=O)OC |
Computed by PubChem (NCBI)