CAS 65815-76-1 appears in our catalog under these names: 4-Nitrophenyl piperidine-1-carboxylate, 98%, 98%, AA38–3, AA38-3/ 99.7% (existing batch purity), AA38-3, 99.95%. Offered by: Chemat, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 5mg, 200mg, 50 mg.
(4-nitrophenyl) piperidine-1-carboxylate (CAS 65815-76-1) is a chemical compound with the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. IUPAC name: (4-nitrophenyl) piperidine-1-carboxylate. InChIKey: DHSYPQIMNAYLCG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | (4-nitrophenyl) piperidine-1-carboxylate |
| InChIKey | DHSYPQIMNAYLCG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)