CAS 847249-57-4 appears in our catalog under these names: AES–350, AES-350/ 99.2% (existing batch purity), AES-350, AES-350, 99.30%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 10mg, 25mg, 50mg, 100mg, 200mg.
4-tert-butyl-N-[4-(hydroxycarbamoyl)phenyl]benzamide (CAS 847249-57-4) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: 4-tert-butyl-N-[4-(hydroxycarbamoyl)phenyl]benzamide. InChIKey: FMOQHLZNJFXULZ-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-tert-butyl-N-[4-(hydroxycarbamoyl)phenyl]benzamide |
| InChIKey | FMOQHLZNJFXULZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C(=O)NO |
Computed by PubChem (NCBI)