Products 1623416-31-8
CAS 1623416-31-8 appears in our catalog under these names: AG–636, AG-636/ 99.19% (existing batch purity), AG-636, AG-636 98+%, AG-636, ≥98%, ≥98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 250mg.
3-methyl-6-[4-(2-methylphenyl)phenyl]benzotriazole-4-carboxylic acid (CAS 1623416-31-8) is a chemical compound with the molecular formula C21H17N3O2 and a molecular weight of 343.4 g/mol. IUPAC name: 3-methyl-6-[4-(2-methylphenyl)phenyl]benzotriazole-4-carboxylic acid. InChIKey: GSBZRCGZLMBSNY-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 3-methyl-6-[4-(2-methylphenyl)phenyl]benzotriazole-4-carboxylic acid |
| InChIKey | GSBZRCGZLMBSNY-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)C3=CC(=C4C(=C3)N=NN4C)C(=O)O |
Computed by PubChem (NCBI)