cas: 1270084-92-8 — see every product listed under this CAS number, including other names
APX-115 free base 99% (CAS 1270084-92-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1216684-25mg |
| cas | 1270084-92-8 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 381.50 Pln | |
| Ambeed | 50mg | 448.25 Pln | |
| Ambeed | 100mg | 526.12 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1216684 |
5-phenyl-4-propyl-2-pyridin-2-yl-1H-pyrazol-3-one (CAS 1270084-92-8) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 5-phenyl-4-propyl-2-pyridin-2-yl-1H-pyrazol-3-one. InChIKey: GIWZEELPLKPYBA-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 5-phenyl-4-propyl-2-pyridin-2-yl-1H-pyrazol-3-one |
| InChIKey | GIWZEELPLKPYBA-UHFFFAOYSA-N |
| SMILES | CCCC1=C(NN(C1=O)C2=CC=CC=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)