CAS 730949-09-4 appears in our catalog under these names: ARTD3/PARP3–IN–1, 3-(4-Oxo-3,4-dihydroquinazolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide, 98%, 98%, ARTD3/PARP3-IN-1, 99.64%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 250mg, 500mg, 5 mg, 10 mg.
3-(4-oxo-3H-quinazolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide (CAS 730949-09-4) is a chemical compound with the molecular formula C17H16N4O2 and a molecular weight of 308.33 g/mol. IUPAC name: 3-(4-oxo-3H-quinazolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide. InChIKey: LHJLGHGHHDKLMY-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O2 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 3-(4-oxo-3H-quinazolin-2-yl)-N-(pyridin-2-ylmethyl)propanamide |
| InChIKey | LHJLGHGHHDKLMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)CCC(=O)NCC3=CC=CC=N3 |
Computed by PubChem (NCBI)