Ac-D-Lys-OH 98%
cas: 58840-79-2 — see every product listed under this CAS number, including other names
Ac-D-Lys-OH 98% (CAS 58840-79-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A818314-100g |
| cas | 58840-79-2 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 18292.75 Pln | |
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 1694.25 Pln | |
| Ambeed | 25g | 5766.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A818314 |
(2R)-2-acetamido-6-aminohexanoic acid (CAS 58840-79-2) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: (2R)-2-acetamido-6-aminohexanoic acid. InChIKey: VEYYWZRYIYDQJM-SSDOTTSWSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2R)-2-acetamido-6-aminohexanoic acid |
| InChIKey | VEYYWZRYIYDQJM-SSDOTTSWSA-N |
| SMILES | CC(=O)N[C@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)