Ac-Glu-OMe, 95%, 95%
cas: 17015-15-5 — see every product listed under this CAS number, including other names
Ac-Glu-OMe, 95%, 95% (CAS 17015-15-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APXP-100mg |
| cas | 17015-15-5 |
| size | 100mg |
| availability | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 947.60 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-acetamido-5-methoxy-5-oxopentanoic acid (CAS 17015-15-5) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid. InChIKey: XDCCXFLKDREFMO-LURJTMIESA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid |
| InChIKey | XDCCXFLKDREFMO-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Ac-glu-ome, (S)-4-Acetamido-5-methoxy-5-oxopentanoic acid, (4S)-4-acetamido-5-methoxy-5-oxopentanoic acid, Acetyl-L-glutamic acid alpha-methyl ester, AC-GLUTAMIC ACID-OME, N-alpha-Acetyl-L-glutamic acid alpha-methyl ester, (4S)-4-acetamido-5-methoxy-5-oxo-pentanoic Acid, N-Acetyl-L-glutamic acid methyl ester, N-Acetyl-L-glutamic acid 1-methyl ester, Acetyl-L-glutamic acid alpha-methyl ester>/= 95% (NMR)