cas: 1946-82-3 — see every product listed under this CAS number, including other names
Ac-Lys-OH 98% (CAS 1946-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A328373-250mg |
| cas | 1946-82-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 659.62 Pln | |
| Ambeed | 100g | 2267.19 Pln | |
| Ambeed | 500g | 8869.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A328373 |
N(2)-acetyl-L-lysine is an acetyl-L-lysine where the acetyl group is located at the N2-posiiton. It has a role as a human metabolite. It is a tautomer of a N(2)-acetyl-L-lysine zwitterion.
Source: ChEBI
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-acetamido-6-aminohexanoic acid |
| InChIKey | VEYYWZRYIYDQJM-ZETCQYMHSA-N |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)