cas: 27914-73-4 — see every product listed under this CAS number, including other names
Acetic acid 4-chlorocarbonyl-phenyl ester, 95% (CAS 27914-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014698-1G |
| cas | 27914-73-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 716.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4-carbonochloridoylphenyl) acetate (CAS 27914-73-4) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: (4-carbonochloridoylphenyl) acetate. InChIKey: CGEOYYBCLBIBLG-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (4-carbonochloridoylphenyl) acetate |
| InChIKey | CGEOYYBCLBIBLG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)