Products 1677-87-8
CAS 1677-87-8 appears in our catalog under these names: Acetophenone-2,4-dinitrophenylhydrazone, Acetophenone-DNPH, Acetophenone-DNPH, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 50mg, 1x50mg, 1x5ml.
2,4-dinitro-N-(1-phenylethylideneamino)aniline (CAS 1677-87-8) is a chemical compound with the molecular formula C14H12N4O4 and a molecular weight of 300.27 g/mol. IUPAC name: 2,4-dinitro-N-(1-phenylethylideneamino)aniline. InChIKey: IMTAQIPVTJOORO-UHFFFAOYSA-N.
| Molecular formula | C14H12N4O4 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | 2,4-dinitro-N-(1-phenylethylideneamino)aniline |
| InChIKey | IMTAQIPVTJOORO-UHFFFAOYSA-N |
| SMILES | CC(=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)