Acid-PEG3-C2-Boc 95%
cas: 1807539-06-5 — see every product listed under this CAS number, including other names
Acid-PEG3-C2-Boc 95% (CAS 1807539-06-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754902-50mg |
| cas | 1807539-06-5 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 175.69 Pln | |
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2406.25 Pln | |
| Ambeed | 10g | 4047.19 Pln | |
| Ambeed | 25g | 8018.81 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754902 |
3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid (CAS 1807539-06-5) is a chemical compound with the molecular formula C14H26O7 and a molecular weight of 306.35 g/mol. IUPAC name: 3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid. InChIKey: VDWZJPCGUNJFEE-UHFFFAOYSA-N.
| Molecular formula | C14H26O7 |
|---|---|
| Molecular weight | 306.35 g/mol |
| IUPAC name | 3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | VDWZJPCGUNJFEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Acid-PEG3-t-butyl ester, Acid-PEG3-C2-Boc, Carboxy-PEG3-t-butyl ester, COOH-PEG3-OtBu, COOH-PEG3-COOtBu, 2,2-dimethyl-4-oxo-3,7,10,13-tetraoxahexadecan-16-oic acid, 15,15-Dimethyl-13-oxo-4,7,10,14-tetraoxahexadecanoic acid, 3-[2-[2-(3-tert-butoxy-3-oxo-propoxy)ethoxy]ethoxy]propanoic acid, Carboxy-PEG3-t-butylester, Carboxy-PEG3-tert-butyl Ester