CAS 146-92-9 appears in our catalog under these names: Adenosine N1-oxide/ 99.24% (existing batch purity), Adenosine N1-Oxide, Adenosine N1-Oxide, min. 95 %, 10 mg, Adenosine N1-Oxide, min. 95 %, 25 mg, Adenosine N1-Oxide, min. 95 %, 50 mg. Offered by: TargetMol, Biosynth, Chemat, Roth, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
(2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 146-92-9) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: QHFLZHVITNUFMV-KQYNXXCUSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | QHFLZHVITNUFMV-KQYNXXCUSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=CN(C2=N)O |
Computed by PubChem (NCBI)