cas: 1002342-83-7 — see every product listed under this CAS number, including other names
Ald-peg3-azide, ≥95%, ≥95% (CAS 1002342-83-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H07V-50mg |
| cas | 1002342-83-7 |
| size | 50mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 467.60 Pln | |
| Chemat | 250mg | 1461.20 Pln | |
| Chemat | 1g | 4331.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetaldehyde (CAS 1002342-83-7) is a chemical compound with the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. IUPAC name: 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetaldehyde. InChIKey: LSLQXIYUMNSETC-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O4 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetaldehyde |
| InChIKey | LSLQXIYUMNSETC-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCC=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)