CAS 205252-36-4 appears in our catalog under these names: D-Alanyl-L-Glutamine, H-D-Ala-Gln-OH, H–D–Ala–Gln–OH, (S)-5-Amino-2-((R)-2-aminopropanamido)-5-oxopentanoic acid, d-Ala-Gln. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 100mg, 250mg, 25mg, 1g, 500mg, 10mg, 250 mg.
(2S)-5-amino-2-[[(2R)-2-aminopropanoyl]amino]-5-oxopentanoic acid (CAS 205252-36-4) is a chemical compound with the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. IUPAC name: (2S)-5-amino-2-[[(2R)-2-aminopropanoyl]amino]-5-oxopentanoic acid. InChIKey: HJCMDXDYPOUFDY-UHNVWZDZSA-N.
| Molecular formula | C8H15N3O4 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | (2S)-5-amino-2-[[(2R)-2-aminopropanoyl]amino]-5-oxopentanoic acid |
| InChIKey | HJCMDXDYPOUFDY-UHNVWZDZSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)N |
Computed by PubChem (NCBI)